Multiple Choice
Provide a systematic name for the molecule.
Provide a systematic name for the molecule.
Be sure to answer all parts. give the IUPAC name for the following compound. 2xsafari
Draw the structure of 4‑isopropyl‑2,4,5‑trimethylheptane.
Give the IUPAC name for the following compound CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2.
Draw a structure for 2,6-dimethyl-4-propylnonane.
Draw a structure for 4-tert-butyl-3-isopropyl-2-methyloctane.
Draw the correct structure for 4-methyl-2-heptanone or 4 methylheptan-2-one.