4. Protein Structure

A glycosidic linkage is analogous to which of the following in proteins?

In proteins, how are peptide bonds formed between two amino acids?

Which molecule acts as an enzyme during the formation of peptide bonds between amino acids?

During the formation of a peptide bond between two amino acids, which molecule is released as a byproduct of the condensation reaction?

In the dipeptide shown below, which answer choice correctly identifies the location of the peptide bond?\[\text{Glycine} - \ce{NH2-CH2-COOH} + \text{Alanine} - \ce{NH2-CH(CH3)-COOH}\]A segment of the resulting dipeptide is:\[\ce{NH2-CH2-CO-NH-CH(CH3)-COOH}\]Which bond is the peptide bond?

Which of the following statements about peptide bonds is true?

The formation of peptide bonds is catalyzed by which portion of the bacterial ribosome?

Which parts of the amino acids (aa1 and aa2) are involved in the formation of a peptide bond?

Which of the following statements correctly describes peptide hormones?