The bonding of two amino acid molecules to form a larger molecule requires:

In the dipeptide shown below, which answer choice correctly identifies the location of the peptide bond? \[ \text{Glycine} - \ce{NH2-CH2-COOH} + \text{Alanine} - \ce{NH2-CH(CH3)-COOH} \] A segment of the resulting dipeptide is: \[ \ce{NH2-CH2-CO-NH-CH(CH3)-COOH} \] Which bond is the peptide bond?

Which of the following best describes the function of a peptide bond in proteins?

Which of the following peptides is most likely to form a covalently bonded dimer?

The two amino acids shown above are joined together by a peptide bond and form a molecule of which of the following in the process?

Amino acids joining together to make a peptide is a good example of a(n) ________ reaction.

A peptidase breaks down peptides into which of the following products?

Which of the following statements about peptide bonds is true?

Which of the following correctly describes the functional groups involved and the bond formed during the dehydration reaction that creates a peptide bond between two amino acids?